CAS 63031-39-0 is the registry number for Bis(4-methylphenyl)-1,2,4-triazine-3-thiol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione (CAS 63031-39-0) is a chemical compound with the molecular formula C17H15N3S and a molecular weight of 293.4 g/mol. IUPAC name: 5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione. InChIKey: ZYXMIZXTCAQENT-UHFFFAOYSA-N.
| Molecular formula | C17H15N3S |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione |
| InChIKey | ZYXMIZXTCAQENT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=S)NN=C2C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)