CAS 630402-22-1 appears in our catalog under these names: 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-1-pentanesulfonic Acid Sodium Salt, >95% (HPLC), Sodium perfluoropentanesulfonate. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 100mg, 10mg.
Sodium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate (CAS 630402-22-1) is a chemical compound with the molecular formula C5F11NaO3S and a molecular weight of 372.09 g/mol. IUPAC name: sodium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate. InChIKey: ILMCRVHLQCCOBM-UHFFFAOYSA-M.
| Molecular formula | C5F11NaO3S |
|---|---|
| Molecular weight | 372.09 g/mol |
| IUPAC name | sodium 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
| InChIKey | ILMCRVHLQCCOBM-UHFFFAOYSA-M |
| SMILES | C(C(C(F)(F)F)(F)F)(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)