CAS 63041-77-0 appears in our catalog under these names: 7-Methylbenzo(alpha)pyrene, 7-Methylbenzo[a]pyrene. Offered by: TRC, Chemat. Available pack sizes: 25mg, 10mg.
7-methylbenzo[a]pyrene (CAS 63041-77-0) is a chemical compound with the molecular formula C21H14 and a molecular weight of 266.3 g/mol. IUPAC name: 7-methylbenzo[a]pyrene. InChIKey: PYVWGNPFWVQISD-UHFFFAOYSA-N.
| Molecular formula | C21H14 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 7-methylbenzo[a]pyrene |
| InChIKey | PYVWGNPFWVQISD-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C3C=CC4=C5C3=C(C2=CC=C1)C=CC5=CC=C4 |
Computed by PubChem (NCBI)