CAS 63042-28-4 appears in our catalog under these names: Estradiol Valerate EP Impurity E (3,17-Divalerate Estradiol), Estradiol Valerate Impurity 5 (Estradiol Valerate EP Impurity E), Estradiol 3,17-Divalerate, >95% (HPLC), Estradiol EP Impurity E, ESTRADIOL DIVALERATE. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
[(8R,9S,13S,14S,17S)-13-methyl-3-pentanoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate (CAS 63042-28-4) is a chemical compound with the molecular formula C28H40O4 and a molecular weight of 440.6 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-13-methyl-3-pentanoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate. InChIKey: XCWCTQWBFLVNMT-RIWVVKKCSA-N.
| Molecular formula | C28H40O4 |
|---|---|
| Molecular weight | 440.6 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-13-methyl-3-pentanoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| InChIKey | XCWCTQWBFLVNMT-RIWVVKKCSA-N |
| SMILES | CCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OC(=O)CCCC)C |
Computed by PubChem (NCBI)