Products 63082-73-5

CAS 63082-73-5 is the registry number for 4,6-dimethyl-1,3,2lambda6-dioxathiane-2,2-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4,6-dimethyl-1,3,2-dioxathiane 2,2-dioxide (CAS 63082-73-5) is a chemical compound with the molecular formula C5H10O4S and a molecular weight of 166.20 g/mol. IUPAC name: 4,6-dimethyl-1,3,2-dioxathiane 2,2-dioxide. InChIKey: SNUUNBNYJHRNPG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10O4S
Molecular weight166.20 g/mol
IUPAC name4,6-dimethyl-1,3,2-dioxathiane 2,2-dioxide
InChIKeySNUUNBNYJHRNPG-UHFFFAOYSA-N
SMILESCC1CC(OS(=O)(=O)O1)C

Computed by PubChem (NCBI)