CAS 6310-47-0 is the registry number for 4,4'-((3,4-Dichlorophenyl)methylene)bis(N,N-dimethylaniline), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3,4-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (CAS 6310-47-0) is a chemical compound with the molecular formula C23H24Cl2N2 and a molecular weight of 399.4 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline. InChIKey: LEQZLEFUEOCYJL-UHFFFAOYSA-N.
| Molecular formula | C23H24Cl2N2 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 4-[(3,4-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| InChIKey | LEQZLEFUEOCYJL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N(C)C)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)