CAS 63101-32-6 is the registry number for Metformin Impurity 17 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid;hydrochloride (CAS 63101-32-6) is a chemical compound with the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. IUPAC name: 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid;hydrochloride. InChIKey: WOUYATLTHNXCBZ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5O2 |
|---|---|
| Molecular weight | 257.68 g/mol |
| IUPAC name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid;hydrochloride |
| InChIKey | WOUYATLTHNXCBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=C(N)N=C(N)N.Cl |
Computed by PubChem (NCBI)