CAS 63125-52-0 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalene-1,7-diamine, 95%, 1,2,3,4-Tetrahydronaphthalene-1,7-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,2,3,4-tetrahydronaphthalene-1,7-diamine (CAS 63125-52-0) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 162.23 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalene-1,7-diamine. InChIKey: FIILISPGQREIBX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 162.23 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalene-1,7-diamine |
| InChIKey | FIILISPGQREIBX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC(=C2)N)N |
Computed by PubChem (NCBI)