CAS 6313-36-6 is the registry number for Benzylthiosulfuric Acid Sodium Salt. Offered by: TRC. Available pack sizes: 2,5g.
Sodium sulfonatosulfanylmethylbenzene (CAS 6313-36-6) is a chemical compound with the molecular formula C7H7NaO3S2 and a molecular weight of 226.3 g/mol. IUPAC name: sodium sulfonatosulfanylmethylbenzene. InChIKey: JNYFTRHOIQYVSN-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | sodium sulfonatosulfanylmethylbenzene |
| InChIKey | JNYFTRHOIQYVSN-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CSS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)