CAS 63134-33-8 appears in our catalog under these names: 4-[(4-Benzyloxyphenyl)sulfonyl]phenol, 97%, 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone, >95% (HPLC), Bisphenol S-monobenzyl ether, 4-((4-(Benzyloxy)phenyl)sulfonyl)phenol 98%, 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Ambeed, HPC Standards. Available pack sizes: 100g, 1g, 25g, 5g, 100mg, 50mg, 500g, 1000g.
4-(4-phenylmethoxyphenyl)sulfonylphenol (CAS 63134-33-8) is a chemical compound with the molecular formula C19H16O4S and a molecular weight of 340.4 g/mol. IUPAC name: 4-(4-phenylmethoxyphenyl)sulfonylphenol. InChIKey: UWPJWCBDMZHMTN-UHFFFAOYSA-N.
| Molecular formula | C19H16O4S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-(4-phenylmethoxyphenyl)sulfonylphenol |
| InChIKey | UWPJWCBDMZHMTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)