CAS 6315-52-2 appears in our catalog under these names: 1,2-Bis(tosyloxy)ethane, >95% (HPLC), 1,2–Bis(tosyloxy)ethane, Ethylene glycol bis-p-toluenesulfonate, 97% , 1,2-Ethanediol ditosylate, 1,2-Bis(tosyloxy)ethane, >99.0%(HPLC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 250g, 25g, 10g, 50g.
2-(4-methylphenyl)sulfonyloxyethyl 4-methylbenzenesulfonate (CAS 6315-52-2) is a chemical compound with the molecular formula C16H18O6S2 and a molecular weight of 370.4 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyloxyethyl 4-methylbenzenesulfonate. InChIKey: LZIPBJBQQPZLOR-UHFFFAOYSA-N.
| Molecular formula | C16H18O6S2 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyloxyethyl 4-methylbenzenesulfonate |
| InChIKey | LZIPBJBQQPZLOR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)