CAS 63166-73-4 appears in our catalog under these names: Phyllanthoside, Phyllanthoside - Phyllanthus acuminatus. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1mg, 5mg.
CAS 63166-73-4 identifies a chemical compound with the molecular formula C40H52O17 and a molecular weight of 804.8 g/mol. InChIKey: VOTNXJVGRXZYOA-VFRDRLLTSA-N.
| Molecular formula | C40H52O17 |
|---|---|
| Molecular weight | 804.8 g/mol |
| InChIKey | VOTNXJVGRXZYOA-VFRDRLLTSA-N |
| SMILES | C[C@@H]1CO[C@]2(C[C@@H]1OC(=O)/C=C/C3=CC=CC=C3)[C@]4(CO4)[C@H]5CC[C@@H](C[C@H]5O2)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C)O)OC(=O)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C)O)OC(=O)C)O |
Computed by PubChem (NCBI)