CAS 63166-90-5 appears in our catalog under these names: 5-Bromo-2-methylbenzo(b)thiophene-1,1-dioxide, 95%, 5-Bromo-2-methylbenzo(b)thiophene-1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-2-methyl-1-benzothiophene 1,1-dioxide (CAS 63166-90-5) is a chemical compound with the molecular formula C9H7BrO2S and a molecular weight of 259.12 g/mol. IUPAC name: 5-bromo-2-methyl-1-benzothiophene 1,1-dioxide. InChIKey: BOTHUOPKKBBNRR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2S |
|---|---|
| Molecular weight | 259.12 g/mol |
| IUPAC name | 5-bromo-2-methyl-1-benzothiophene 1,1-dioxide |
| InChIKey | BOTHUOPKKBBNRR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1(=O)=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)