CAS 63179-81-7 appears in our catalog under these names: Zinc l-lactate, 98%, Bis[(2S)-2-(hydroxy-κO)propanoato-κO]zinc, 98+%, Zinc L-lactate. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 1g, 500g, 100g, 25g, 5g, on request, 250g, 1000g.
Bis((2S)-2-hydroxypropanoic acid);zinc (CAS 63179-81-7) is a chemical compound with the molecular formula C6H12O6Zn and a molecular weight of 245.5 g/mol. IUPAC name: bis((2S)-2-hydroxypropanoic acid);zinc. InChIKey: GWUDZEJIEQLLHN-CEOVSRFSSA-N.
| Molecular formula | C6H12O6Zn |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | bis((2S)-2-hydroxypropanoic acid);zinc |
| InChIKey | GWUDZEJIEQLLHN-CEOVSRFSSA-N |
| SMILES | C[C@@H](C(=O)O)O.C[C@@H](C(=O)O)O.[Zn] |
Computed by PubChem (NCBI)