CAS 63183-44-8 appears in our catalog under these names: Rhodizonic acid dihydrate, 98%, Rhodizonic acid dihydrate, Rhodizonic acid dihydrate, 98% , Rhodizonic acid dihydrate. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 250mg, 25g, 10g, 50g, 100g.
2,3,5,5,6,6-hexahydroxycyclohex-2-ene-1,4-dione (CAS 63183-44-8) is a chemical compound with the molecular formula C6H6O8 and a molecular weight of 206.11 g/mol. IUPAC name: 2,3,5,5,6,6-hexahydroxycyclohex-2-ene-1,4-dione. InChIKey: GYOVGUVIMWSHSF-UHFFFAOYSA-N.
| Molecular formula | C6H6O8 |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 2,3,5,5,6,6-hexahydroxycyclohex-2-ene-1,4-dione |
| InChIKey | GYOVGUVIMWSHSF-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=O)C(C(C1=O)(O)O)(O)O)O)O |
Computed by PubChem (NCBI)