Products 63185-07-9

CAS 63185-07-9 is the registry number for 3-Hydroxy-1-methyl-5-pyridin-4yl-1H-pyrrole-2,4-dicarboxylic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Diethyl 3-hydroxy-1-methyl-5-pyridin-4-ylpyrrole-2,4-dicarboxylate (CAS 63185-07-9) is a chemical compound with the molecular formula C16H18N2O5 and a molecular weight of 318.32 g/mol. IUPAC name: diethyl 3-hydroxy-1-methyl-5-pyridin-4-ylpyrrole-2,4-dicarboxylate. InChIKey: TTWGEJQAAIBFMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18N2O5
Molecular weight318.32 g/mol
IUPAC namediethyl 3-hydroxy-1-methyl-5-pyridin-4-ylpyrrole-2,4-dicarboxylate
InChIKeyTTWGEJQAAIBFMZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(C(=C1O)C(=O)OCC)C)C2=CC=NC=C2

Computed by PubChem (NCBI)