CAS 63185-48-8 is the registry number for 2-(6-(trifluoromethyl)-2H,3H,4H-2,5-diazepinyl)thiophene. Offered by: Biosynth. Available pack sizes: 250mg.
5-thiophen-2-yl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine (CAS 63185-48-8) is a chemical compound with the molecular formula C10H9F3N2S and a molecular weight of 246.25 g/mol. IUPAC name: 5-thiophen-2-yl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine. InChIKey: UTVTXTYRRBFSLK-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2S |
|---|---|
| Molecular weight | 246.25 g/mol |
| IUPAC name | 5-thiophen-2-yl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine |
| InChIKey | UTVTXTYRRBFSLK-UHFFFAOYSA-N |
| SMILES | C1CN=C(C=C(N1)C(F)(F)F)C2=CC=CS2 |
Computed by PubChem (NCBI)