Products 632-58-6
CAS 632-58-6 appears in our catalog under these names: Tetrachlorophthalic acid, 95%, Tetrachlorophthalic acid hydrate, 98%, Tetrachlorophthalic acid hemihydrate, 95%, Tetrachlorophthalic Acid Hemihydrate, Tetrachlorophthalic Acid Hemihydrate, >98.0%(T). Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 5g, 500g, 100g, 25g, 1g, 0,25kg, 0,1kg, 0,5kg.
3,4,5,6-tetrachlorophthalic acid (CAS 632-58-6) is a chemical compound with the molecular formula C8H2Cl4O4 and a molecular weight of 303.9 g/mol. IUPAC name: 3,4,5,6-tetrachlorophthalic acid. InChIKey: WZHHYIOUKQNLQM-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl4O4 |
|---|---|
| Molecular weight | 303.9 g/mol |
| IUPAC name | 3,4,5,6-tetrachlorophthalic acid |
| InChIKey | WZHHYIOUKQNLQM-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
TETRACHLOROPHTHALIC ACID, Phthalic acid, perchloro-, Phthalic acid, tetrachloro-, 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrachloro-, 3,4,5,6-Tetrachloro-1,2-benzenedicarboxylic acid, 3-09-00-04205 (Beilstein Handbook Reference), Tetrachloro-1,2-benzenedicarboxylic acid, 3,4,5,6-Tetrachlorophthalic acid, C8H2Cl4O4, 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylic acid