Products 63211-97-2

CAS 63211-97-2 is the registry number for Pyrimidine-4,5-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Pyrimidine-4,5-diamine;hydrochloride (CAS 63211-97-2) is a chemical compound with the molecular formula C4H7ClN4 and a molecular weight of 146.58 g/mol. IUPAC name: pyrimidine-4,5-diamine;hydrochloride. InChIKey: HXBNENHPZIJFTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClN4
Molecular weight146.58 g/mol
IUPAC namepyrimidine-4,5-diamine;hydrochloride
InChIKeyHXBNENHPZIJFTQ-UHFFFAOYSA-N
SMILESC1=C(C(=NC=N1)N)N.Cl

Computed by PubChem (NCBI)