CAS 63212-44-2 appears in our catalog under these names: 2-(4,5-dimethoxy-2-(morpholin-4-ylsulfonyl)phenyl)acetic acid, [4,5-Dimethoxy-2-(morpholine-4-sulfonyl)-phenyl]-acetic acid, 99%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5000mg, 10000mg, 1g.
2-(4,5-dimethoxy-2-morpholin-4-ylsulfonylphenyl)acetic acid (CAS 63212-44-2) is a chemical compound with the molecular formula C14H19NO7S and a molecular weight of 345.37 g/mol. IUPAC name: 2-(4,5-dimethoxy-2-morpholin-4-ylsulfonylphenyl)acetic acid. InChIKey: DFFNNBNUBYYXQT-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7S |
|---|---|
| Molecular weight | 345.37 g/mol |
| IUPAC name | 2-(4,5-dimethoxy-2-morpholin-4-ylsulfonylphenyl)acetic acid |
| InChIKey | DFFNNBNUBYYXQT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)S(=O)(=O)N2CCOCC2)OC |
Computed by PubChem (NCBI)