CAS 63212-53-3 appears in our catalog under these names: 2-Chloro-3-ethylbenzo(d)oxazol-3-ium tetrafluoroborate, 97%, 2-Chloro-3-ethylbenzo[d]oxazol-3-ium tetrafluoroborate, 97%, 97%, 2–Chloro–3–ethylbenzoxazolium Tetrafluoroborate, 2-Chloro-3-ethylbenzoxazolium tetrafluoroborate, 2-Chloro-3-ethylbenzoxazolium tetrafluoroborate, 97%. Offered by: AmBeed, Chemat, GLPBio, Biosynth, Combi-blocks. Available pack sizes: 1g, 25g, 5g, 10g.
2-chloro-3-ethyl-1,3-benzoxazol-3-ium tetrafluoroborate (CAS 63212-53-3) is a chemical compound with the molecular formula C9H9BClF4NO and a molecular weight of 269.43 g/mol. IUPAC name: 2-chloro-3-ethyl-1,3-benzoxazol-3-ium tetrafluoroborate. InChIKey: MLQZANYFUYLJRK-UHFFFAOYSA-N.
| Molecular formula | C9H9BClF4NO |
|---|---|
| Molecular weight | 269.43 g/mol |
| IUPAC name | 2-chloro-3-ethyl-1,3-benzoxazol-3-ium tetrafluoroborate |
| InChIKey | MLQZANYFUYLJRK-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC[N+]1=C(OC2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)