Products 63231-73-2

CAS 63231-73-2 is the registry number for Di-sec-Butylsulfate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dibutan-2-yl sulfate (CAS 63231-73-2) is a chemical compound with the molecular formula C8H18O4S and a molecular weight of 210.29 g/mol. IUPAC name: dibutan-2-yl sulfate. InChIKey: KYAMUOMYFJTMPP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18O4S
Molecular weight210.29 g/mol
IUPAC namedibutan-2-yl sulfate
InChIKeyKYAMUOMYFJTMPP-UHFFFAOYSA-N
SMILESCCC(C)OS(=O)(=O)OC(C)CC

Computed by PubChem (NCBI)