CAS 632322-61-3 appears in our catalog under these names: Azilsartan Impurity 40, Azilsartan Impurity 4, 3-((4-(2-Cyanophenyl)phenyl)methyl)-2-ethoxybenzimidazole-4-carboxylic acid, 1-((2'-Cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1h-benzo[d]imidazole-7-carboxylic acid, 95%, 95%, Azilsartan Impurity 30, 95.0%. Offered by: Chemat Brand, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 50mg, 25mg, 100mg, 250mg, 1g, Get quote.
3-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid (CAS 632322-61-3) is a chemical compound with the molecular formula C24H19N3O3 and a molecular weight of 397.4 g/mol. IUPAC name: 3-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid. InChIKey: IXRVVLKQIVDIEM-UHFFFAOYSA-N.
| Molecular formula | C24H19N3O3 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylic acid |
| InChIKey | IXRVVLKQIVDIEM-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C#N)C(=O)O |
Computed by PubChem (NCBI)