CAS 632324-38-0 appears in our catalog under these names: (2,5-Diiodo-1,4-phenylene)bis(trimethylsilane), 98%, 98%, (2,5-Diiodo-1,4-phenylene)bis(trimethylsilane), 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(2,5-diiodo-4-trimethylsilylphenyl)-trimethylsilane (CAS 632324-38-0) is a chemical compound with the molecular formula C12H20I2Si2 and a molecular weight of 474.27 g/mol. IUPAC name: (2,5-diiodo-4-trimethylsilylphenyl)-trimethylsilane. InChIKey: ORBCRPGXGNWETM-UHFFFAOYSA-N.
| Molecular formula | C12H20I2Si2 |
|---|---|
| Molecular weight | 474.27 g/mol |
| IUPAC name | (2,5-diiodo-4-trimethylsilylphenyl)-trimethylsilane |
| InChIKey | ORBCRPGXGNWETM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC(=C(C=C1I)[Si](C)(C)C)I |
Computed by PubChem (NCBI)