CAS 63289-85-0 appears in our catalog under these names: 2,2-Dichlorocyclopropyl phenyl sulfide, 97%, 2,2–Dichlorocyclopropyl Phenyl Sulfide, 2,2-Dichlorocyclopropyl Phenyl Sulfide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 200mg, 10g.
(2,2-dichlorocyclopropyl)sulfanylbenzene (CAS 63289-85-0) is a chemical compound with the molecular formula C9H8Cl2S and a molecular weight of 219.13 g/mol. IUPAC name: (2,2-dichlorocyclopropyl)sulfanylbenzene. InChIKey: DIHSMJVOQUSOTO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2S |
|---|---|
| Molecular weight | 219.13 g/mol |
| IUPAC name | (2,2-dichlorocyclopropyl)sulfanylbenzene |
| InChIKey | DIHSMJVOQUSOTO-UHFFFAOYSA-N |
| SMILES | C1C(C1(Cl)Cl)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)