CAS 633-66-9 appears in our catalog under these names: Berberine hydrogen sulphate, 98%, Berberine Sulfate, >95% (HPLC), Berberine Sulfate, Berberine hydrogen sulphate/ 99.42% (existing batch purity), Berberine hydrogen sulphate. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g, 250mg, 20mg, 50mg, 100mg.
16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;hydrogen sulfate (CAS 633-66-9) is a chemical compound with the molecular formula C20H19NO8S and a molecular weight of 433.4 g/mol. IUPAC name: 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;hydrogen sulfate. InChIKey: JISRTQBQFQMSLG-UHFFFAOYSA-M.
| Molecular formula | C20H19NO8S |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;hydrogen sulfate |
| InChIKey | JISRTQBQFQMSLG-UHFFFAOYSA-M |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)