CAS 63301-31-5 is the registry number for trans-2-Hydroxycyclohexanecarbonitrile. Offered by: Chemat. Available pack sizes: 2mg, 10mg.
Cis-(1S,2R)-2-hydroxycyclohexane-1-carbonitrile (CAS 63301-31-5) is a chemical compound with the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. IUPAC name: cis-(1S,2R)-2-hydroxycyclohexane-1-carbonitrile. InChIKey: MFPCXQNVYPKUSM-NKWVEPMBSA-N.
| Molecular formula | C7H11NO |
|---|---|
| Molecular weight | 125.17 g/mol |
| IUPAC name | cis-(1S,2R)-2-hydroxycyclohexane-1-carbonitrile |
| InChIKey | MFPCXQNVYPKUSM-NKWVEPMBSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C#N)O |
Computed by PubChem (NCBI)