CAS 63310-10-1 appears in our catalog under these names: Fluorescent whitening agent KCB, Fluorescent Whitening Agent Kcb, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 5g, 25g.
2-[4-(1,3-benzoxazol-2-yl)naphthalen-1-yl]-1,3-benzoxazole (CAS 63310-10-1) is a chemical compound with the molecular formula C24H14N2O2 and a molecular weight of 362.4 g/mol. IUPAC name: 2-[4-(1,3-benzoxazol-2-yl)naphthalen-1-yl]-1,3-benzoxazole. InChIKey: WFYSPVCBIJCZPX-UHFFFAOYSA-N.
| Molecular formula | C24H14N2O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[4-(1,3-benzoxazol-2-yl)naphthalen-1-yl]-1,3-benzoxazole |
| InChIKey | WFYSPVCBIJCZPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=NC4=CC=CC=C4O3)C5=NC6=CC=CC=C6O5 |
Computed by PubChem (NCBI)