CAS 63328-18-7 appears in our catalog under these names: 1,2,2A,3,4,5-hexahydroacenaphthylen-1-one, 95%, 1,2,2a,3,4,5-Hexahydroacenaphthylen-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3a,4,5-tetrahydro-2H-acenaphthylen-1-one (CAS 63328-18-7) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 3,3a,4,5-tetrahydro-2H-acenaphthylen-1-one. InChIKey: VJGRLMALXXVDDV-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 3,3a,4,5-tetrahydro-2H-acenaphthylen-1-one |
| InChIKey | VJGRLMALXXVDDV-UHFFFAOYSA-N |
| SMILES | C1CC2CC(=O)C3=CC=CC(=C23)C1 |
Computed by PubChem (NCBI)