Products 633317-53-0
CAS 633317-53-0 is the registry number for MK-0916. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[1-(4-chlorophenyl)-3-fluorocyclobutyl]-4,5-dicyclopropyl-1,2,4-triazole (CAS 633317-53-0) is a chemical compound with the molecular formula C18H19ClFN3 and a molecular weight of 331.8 g/mol. IUPAC name: 3-[1-(4-chlorophenyl)-3-fluorocyclobutyl]-4,5-dicyclopropyl-1,2,4-triazole. InChIKey: OGYZYOKAXYFLIU-UHFFFAOYSA-N.
| Molecular formula | C18H19ClFN3 |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 3-[1-(4-chlorophenyl)-3-fluorocyclobutyl]-4,5-dicyclopropyl-1,2,4-triazole |
| InChIKey | OGYZYOKAXYFLIU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C(N2C3CC3)C4(CC(C4)F)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)