CAS 633327-36-3 appears in our catalog under these names: (E)-2-(3-Fluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, (E)-2-(3-Fluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-[(E)-2-(3-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 633327-36-3) is a chemical compound with the molecular formula C14H18BFO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-[(E)-2-(3-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XKOFTHAMHDHSMB-CMDGGOBGSA-N.
| Molecular formula | C14H18BFO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XKOFTHAMHDHSMB-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)