CAS 63333-31-3 is the registry number for Desmethyl Des-2,4,6-Tribromo Bromethalin, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline (CAS 63333-31-3) is a chemical compound with the molecular formula C13H8F3N3O4 and a molecular weight of 327.21 g/mol. IUPAC name: 2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline. InChIKey: BFRXEPDACBYGRZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F3N3O4 |
|---|---|
| Molecular weight | 327.21 g/mol |
| IUPAC name | 2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline |
| InChIKey | BFRXEPDACBYGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)