CAS 63335-24-0 appears in our catalog under these names: Malabaricone B, >95% (HPLC), Malabaricone B, Malabaricone B/ 99.84% (existing batch purity), Malabaricone B, Malabaricone B, 99.58%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 2mg, 10 mg, 5 mg.
1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one (CAS 63335-24-0) is a chemical compound with the molecular formula C21H26O4 and a molecular weight of 342.4 g/mol. IUPAC name: 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one. InChIKey: KOAPDMKKECXPHX-UHFFFAOYSA-N.
| Molecular formula | C21H26O4 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one |
| InChIKey | KOAPDMKKECXPHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C(=O)CCCCCCCCC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)