Products 63335-24-0

CAS 63335-24-0 appears in our catalog under these names: Malabaricone B, >95% (HPLC), Malabaricone B, Malabaricone B/ 99.84% (existing batch purity), Malabaricone B, Malabaricone B, 99.58%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 2mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one (CAS 63335-24-0) is a chemical compound with the molecular formula C21H26O4 and a molecular weight of 342.4 g/mol. IUPAC name: 1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one. InChIKey: KOAPDMKKECXPHX-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26O4
Molecular weight342.4 g/mol
IUPAC name1-(2,6-dihydroxyphenyl)-9-(4-hydroxyphenyl)nonan-1-one
InChIKeyKOAPDMKKECXPHX-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)O)C(=O)CCCCCCCCC2=CC=C(C=C2)O)O

Computed by PubChem (NCBI)