CAS 63351-80-4 is the registry number for Gibberellin A63. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
7,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid (CAS 63351-80-4) is a chemical compound with the molecular formula C19H24O6 and a molecular weight of 348.4 g/mol. IUPAC name: 7,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid. InChIKey: RLZBXKKKLIYURW-UHFFFAOYSA-N.
| Molecular formula | C19H24O6 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 7,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| InChIKey | RLZBXKKKLIYURW-UHFFFAOYSA-N |
| SMILES | CC12C(CCC3(C1C(C45C3CCC(C4)C(=C)C5O)C(=O)O)OC2=O)O |
Computed by PubChem (NCBI)