Products 142733-60-6

CAS 142733-60-6 is the registry number for 2,2-Diethyl 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate (CAS 142733-60-6) is a chemical compound with the molecular formula C19H24O6 and a molecular weight of 348.4 g/mol. IUPAC name: diethyl 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate. InChIKey: ULSMYZADTHVDKB-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24O6
Molecular weight348.4 g/mol
IUPAC namediethyl 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate
InChIKeyULSMYZADTHVDKB-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC2(C1)COC(OC2)C3=CC=CC=C3)C(=O)OCC

Computed by PubChem (NCBI)