CAS 6336-51-2 appears in our catalog under these names: Bismuthiol ii hydrate, 95%, 5-Mercapto-3-phenyl-1,3,4-thiadiazole-2(3h)thione potassium salt, 95%, Potassium 4-phenyl-5-thioxo-4,5-dihydro-1,3,4-thiadiazole-2-thiolate, 98+%, Bismuthiol II Hydrate, Bismuthiol II. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 25g, 1g, 2,5g, 0,25g.
Potassium 4-phenyl-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate (CAS 6336-51-2) is a chemical compound with the molecular formula C8H5KN2S3 and a molecular weight of 264.4 g/mol. IUPAC name: potassium 4-phenyl-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate. InChIKey: QSKDCVGFAPHSHX-UHFFFAOYSA-M.
| Molecular formula | C8H5KN2S3 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | potassium 4-phenyl-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate |
| InChIKey | QSKDCVGFAPHSHX-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)N2C(=S)SC(=N2)[S-].[K+] |
Computed by PubChem (NCBI)