CAS 6337-82-2 is the registry number for 1-Chloro-4-nitroanthracene-9,10-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-4-nitroanthracene-9,10-dione (CAS 6337-82-2) is a chemical compound with the molecular formula C14H6ClNO4 and a molecular weight of 287.65 g/mol. IUPAC name: 1-chloro-4-nitroanthracene-9,10-dione. InChIKey: FLEURRNKVDUGOR-UHFFFAOYSA-N.
| Molecular formula | C14H6ClNO4 |
|---|---|
| Molecular weight | 287.65 g/mol |
| IUPAC name | 1-chloro-4-nitroanthracene-9,10-dione |
| InChIKey | FLEURRNKVDUGOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)