CAS 63386-40-3 is the registry number for D-Phenylalaninol-d2. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2R)-2-amino-1,1-dideuterio-3-phenylpropan-1-ol (CAS 63386-40-3) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 153.22 g/mol. IUPAC name: (2R)-2-amino-1,1-dideuterio-3-phenylpropan-1-ol. InChIKey: STVVMTBJNDTZBF-VJQDKCMBSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | (2R)-2-amino-1,1-dideuterio-3-phenylpropan-1-ol |
| InChIKey | STVVMTBJNDTZBF-VJQDKCMBSA-N |
| SMILES | [2H]C([2H])([C@@H](CC1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)