Products 63406-22-4

CAS 63406-22-4 is the registry number for 3-(2-Chloroethynyl)-2,2-dimethylcyclopropanecarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

3-(2-chloroethynyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 63406-22-4) is a chemical compound with the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. IUPAC name: 3-(2-chloroethynyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: BWLHXMCCPUJBSW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO2
Molecular weight172.61 g/mol
IUPAC name3-(2-chloroethynyl)-2,2-dimethylcyclopropane-1-carboxylic acid
InChIKeyBWLHXMCCPUJBSW-UHFFFAOYSA-N
SMILESCC1(C(C1C(=O)O)C#CCl)C

Computed by PubChem (NCBI)