CAS 634176-88-8 is the registry number for N(1)-(1-Phenylethyl)-4-(trifluoromethyl)benzene-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-N-(1-phenylethyl)-4-(trifluoromethyl)benzene-1,2-diamine (CAS 634176-88-8) is a chemical compound with the molecular formula C15H15F3N2 and a molecular weight of 280.29 g/mol. IUPAC name: 1-N-(1-phenylethyl)-4-(trifluoromethyl)benzene-1,2-diamine. InChIKey: UDNUBMMZVVKNQL-UHFFFAOYSA-N.
| Molecular formula | C15H15F3N2 |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | 1-N-(1-phenylethyl)-4-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | UDNUBMMZVVKNQL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)