CAS 63418-08-6 appears in our catalog under these names: 2,6-Dichloro-3,5-difluorophenol, 95%, 2,6-Dichloro-3,5-difluorophenol, 95+%, 2,6-Dichloro-3,5-difluorophenol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100g, 25g, 10g, 1g, 5g.
2,6-dichloro-3,5-difluorophenol (CAS 63418-08-6) is a chemical compound with the molecular formula C6H2Cl2F2O and a molecular weight of 198.98 g/mol. IUPAC name: 2,6-dichloro-3,5-difluorophenol. InChIKey: RBVUEUWRQAOTDL-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O |
|---|---|
| Molecular weight | 198.98 g/mol |
| IUPAC name | 2,6-dichloro-3,5-difluorophenol |
| InChIKey | RBVUEUWRQAOTDL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)O)Cl)F |
Computed by PubChem (NCBI)