CAS 634193-29-6 is the registry number for EP4 receptor agonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (CAS 634193-29-6) is a chemical compound with the molecular formula C21H27F2NO4 and a molecular weight of 395.4 g/mol. IUPAC name: 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid. InChIKey: HWLGHEIVNKULQQ-SLKVGHROSA-N.
| Molecular formula | C21H27F2NO4 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| InChIKey | HWLGHEIVNKULQQ-SLKVGHROSA-N |
| SMILES | C1CC(=O)N([C@H]1/C=C/[C@H](C(C2=CC=CC=C2)(F)F)O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)