CAS 6344-61-2 appears in our catalog under these names: Fluoren-1-ol, >95% (HPLC), Fluoren-1-ol, Fluoren-1-ol, 98%, 98%, 9H-Fluoren-1-ol, 98%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 5mg, 25mg, 100mg, 10mg.
9H-fluoren-1-ol (CAS 6344-61-2) is a chemical compound with the molecular formula C13H10O and a molecular weight of 182.22 g/mol. IUPAC name: 9H-fluoren-1-ol. InChIKey: PWFLISNWYDWJHX-UHFFFAOYSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 9H-fluoren-1-ol |
| InChIKey | PWFLISNWYDWJHX-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)O |
Computed by PubChem (NCBI)