Products 634468-87-4

CAS 634468-87-4 is the registry number for 4-(4-BOC-Piperazino)pyrimidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-pyrimidin-4-ylpiperazine-1-carboxylate;hydrochloride (CAS 634468-87-4) is a chemical compound with the molecular formula C13H21ClN4O2 and a molecular weight of 300.78 g/mol. IUPAC name: tert-butyl 4-pyrimidin-4-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: NDRUXAAEJIXVPK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21ClN4O2
Molecular weight300.78 g/mol
IUPAC nametert-butyl 4-pyrimidin-4-ylpiperazine-1-carboxylate;hydrochloride
InChIKeyNDRUXAAEJIXVPK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=NC=NC=C2.Cl

Computed by PubChem (NCBI)