Products 63468-09-7

CAS 63468-09-7 is the registry number for 1,2,4-Benzenetricarboxylic Acid 1,2-Bis(2-ethylhexyl) Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 2,5mg.

Structural formula: {0} (CAS {1})

3,4-bis(2-ethylhexoxycarbonyl)benzoic acid (CAS 63468-09-7) is a chemical compound with the molecular formula C25H38O6 and a molecular weight of 434.6 g/mol. IUPAC name: 3,4-bis(2-ethylhexoxycarbonyl)benzoic acid. InChIKey: UVGGJHWAFDJNPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC25H38O6
Molecular weight434.6 g/mol
IUPAC name3,4-bis(2-ethylhexoxycarbonyl)benzoic acid
InChIKeyUVGGJHWAFDJNPJ-UHFFFAOYSA-N
SMILESCCCCC(CC)COC(=O)C1=C(C=C(C=C1)C(=O)O)C(=O)OCC(CC)CCCC

Computed by PubChem (NCBI)