CAS 63480-10-4 appears in our catalog under these names: 4-Nitroisatoic anhydride 95%, 4-Nitro-isatoic anhydride, 95%, 7–Nitro–1H–benzo(d)(1,3)oxazine–2,4–dione, 7-Nitro-1H-benzo[d][1,3]oxazine-2,4-dione, 95%, 95%. Offered by: Ambeed, Fluorochem, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
7-nitro-1H-3,1-benzoxazine-2,4-dione (CAS 63480-10-4) is a chemical compound with the molecular formula C8H4N2O5 and a molecular weight of 208.13 g/mol. IUPAC name: 7-nitro-1H-3,1-benzoxazine-2,4-dione. InChIKey: KCNIWFFVWBXWAV-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O5 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 7-nitro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | KCNIWFFVWBXWAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=O)OC2=O |
Computed by PubChem (NCBI)