Products 63484-11-7

CAS 63484-11-7 is the registry number for Tiapride EP Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide (CAS 63484-11-7) is a chemical compound with the molecular formula C15H24N2O5S and a molecular weight of 344.4 g/mol. IUPAC name: N,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide. InChIKey: HQQARYRCDMYLHW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24N2O5S
Molecular weight344.4 g/mol
IUPAC nameN,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide
InChIKeyHQQARYRCDMYLHW-UHFFFAOYSA-N
SMILESCC[N+](CC)(CCNC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)OC)[O-]

Computed by PubChem (NCBI)