CAS 63484-11-7 is the registry number for Tiapride EP Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide (CAS 63484-11-7) is a chemical compound with the molecular formula C15H24N2O5S and a molecular weight of 344.4 g/mol. IUPAC name: N,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide. InChIKey: HQQARYRCDMYLHW-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O5S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | N,N-diethyl-2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]ethanamine oxide |
| InChIKey | HQQARYRCDMYLHW-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CCNC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)OC)[O-] |
Computed by PubChem (NCBI)