Products 634897-84-0
CAS 634897-84-0 appears in our catalog under these names: n-Heptylbenzene-d20, 98 atom % D, min 98% Chemical Purity, Heptylbenzene-d20. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptyl)benzene (CAS 634897-84-0) is a chemical compound with the molecular formula C13H20 and a molecular weight of 196.42 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptyl)benzene. InChIKey: LBNXAWYDQUGHGX-JAYKIUHLSA-N.
| Molecular formula | C13H20 |
|---|---|
| Molecular weight | 196.42 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptyl)benzene |
| InChIKey | LBNXAWYDQUGHGX-JAYKIUHLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)