CAS 634911-84-5 is the registry number for 3-((Trimethylsilyl)ethynyl)cyclopent-2-en-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol (CAS 634911-84-5) is a chemical compound with the molecular formula C10H16OSi and a molecular weight of 180.32 g/mol. IUPAC name: 3-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol. InChIKey: TXOBWOBAIVXLOV-UHFFFAOYSA-N.
| Molecular formula | C10H16OSi |
|---|---|
| Molecular weight | 180.32 g/mol |
| IUPAC name | 3-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
| InChIKey | TXOBWOBAIVXLOV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(CC1)O |
Computed by PubChem (NCBI)