Products 63497-59-6
CAS 63497-59-6 appears in our catalog under these names: 4-Amino-2-chloro-N-cyclohexyl-N-methylbenzamide, 95%, 4-Amino-2-chloro-N-cyclohexyl-N-methylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-amino-2-chloro-N-cyclohexyl-N-methylbenzamide (CAS 63497-59-6) is a chemical compound with the molecular formula C14H19ClN2O and a molecular weight of 266.76 g/mol. IUPAC name: 4-amino-2-chloro-N-cyclohexyl-N-methylbenzamide. InChIKey: PJQHZLLJVRSICO-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O |
|---|---|
| Molecular weight | 266.76 g/mol |
| IUPAC name | 4-amino-2-chloro-N-cyclohexyl-N-methylbenzamide |
| InChIKey | PJQHZLLJVRSICO-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)C(=O)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)